Select all that apply. 1) Molecular compounds tend to contain nonmetals only. 2) Molecular compounds may contain ions. 3) Ionic compounds are composed of molecules. 4) Ionic compounds contain only one type of atom. 5) Nonmetals combine with metals to form ionic compounds. 1 and 5. Which of the following options correctly describe how to name an ... Which of the following statements correctly describe covalent compounds? Select all that apply. Most of the compounds that we come in contact with are covalent compounds. Covalent compounds are formed by sharing electrons between atoms. Nitrogen, N2, is a covalent compound. 1. Correctly order the steps followed in writing the formula of an ionic compound containing a polyatomic ion. 1. Identify the formulas and charges of the cation and anion. 2. Determine how many of each ion type is needed to make a neutral compound. 3. Place the cation first in the formula, followed by the anion.Which of the following could Alexa use to correctly describe the relationship between elements and compounds? Two compounds are required to make one element in natural systems. There is a finite number of elements that can be used to create a multitude of compounds. Question: Which of the following correctly describes a compound? a. The atoms are bonded together, and the compound has different physical and chemical properties than the individual...1 millimeter = __________ meter. 0.001. Perform the following calculation and give the answer with the correct number of significant figures. 35,920 ÷ 172. 209. Gasoline has a density of 0.740 g/mL. If you have 328 grams of gasoline, what is the volume in milliliters?Example 1. Write the name of each binary covalent compound. SF 6; N 2 O 4; ClO 2; Given: molecular formula Asked for: name of compound Strategy: A List the elements in order according to their positions in the periodic table. Identify the number of each type of atom in the chemical formula and then use Table 6.1.1 to determine the prefixes needed.. …Jan 20, 2021 · The correct option that describes a compound is: "The atoms can only combine in fixed ratios, and they can only be separated by a chemical change."Explanation: A compound is defined as a substance composed of two or more different types of elements that are chemically combined in fixed proportions. Classify each of the following substances as an element, a compound, a homogeneous mixture, or a heterogeneous mixture. Sucrose, which is commonly-known as "table sugar" (C 12 H 22 O 11) 2.1: Classifications of Matter is shared under a not declared license and was authored, remixed, and/or curated by LibreTexts.6) Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound?See full list on khanacademy.org Define compound adjective: the definition of compound adjective is a phrase or set of words taken as a unit to modify a noun. In summary, a compound adjective is, an adjective that modifies a noun. made up of more than one word. usually hyphenated.compound. [ kŏm′pound′ ] A substance consisting of atoms or ions of two or more different elements in definite proportions joined by chemical bonds into a molecule. The elements cannot be separated by physical means. Water, for example, is a compound having two hydrogen atoms and one oxygen atom per molecule.Which of the following incorrectly describes cis-1.2-dimethylcyclopentane? A) It is a meso compound B) It is achiral. C) It contains two asymmetric carbons D) Its diastcreomer is trans- 1.2-dimethylcyclopentane E) It has an enantiomer. 2. What is the relationship between the pair of compounds shown: CMa A) enantiomers, B) diastereomers C) the sameExpert-verified. Answer) Option d. Explanation: Microscope is an instrument used to see the microscopic organisms. Th …. Which of the following best describes the function of the field diaphragm on a compound microscope: Select one: O a. The field diaphragm permits researchers to use microscopes in the field. O b.Study with Quizlet and memorize flashcards containing terms like In general the formation of a chemical bond lowers the ____ energy of a chemical system leading to a ____ stable arrangement., Which of the following statements correctly describe ionic bonding?, Which statement correctly describes the general characteristics of a covalent bond? and more.SmartBook 1. Which of the following statements correctly describe covalent compounds? Select all that apply. Click the card to flip 👆. Most of the compounds that we come in contact with are covalent compounds. Covalent compounds are formed by sharing electrons between atoms. Covalent compounds contain covalent bonds.User: Which of the following describes the formation of a compound sentence? Weegy: A compound sentence is formed by joining two simple sentences with a comma and a coordinating conjunction. Score 1 User: Whats a claim? Weegy: A claim is: a statement essentially arguable, but used as a primary point to support or prove an …Chapter 3. Which of the following describes a substance in the liquid physical state? A) The substance has a variable shape. B) The substance has a fixed volume. C) The substance does not compress significantly. D) all of the above. E) none of the above. Click the card to flip 👆.Study with Quizlet and memorize flashcards containing terms like Which of the following statements best describes the relationship between autotrophs and heterotrophs? A) Autotrophs produce their organic molecules from CO2 and other inorganic molecules, whereas heterotrophs obtain their organic molecules from compounds produced by …d.spiro bicyclic. 2.Which of the following describes the compound below? A. bridged bicyclic. B. spiro bicyclic. C. fused bicyclic. D. bridged tricyclic. 3.Choose the IUPAC name that best describes the following molecule. a.spiro [5.2]octane. b.bicyclo [3.2.1]octane. Scientists of the 18th and early 19th centuries studied compounds obtained from plants and animals and labeled them organic because they were isolated from “organized” (living) systems. Compounds isolated from nonliving systems, such as rocks and ores, the atmosphere, and the oceans, were labeled inorganic.For many years, …Only 1. Match the molecular geometry and the number of lone pairs of electrons on the central atom: Bent geometry. - 0. - Only 1. - 1 or 2. 1 or 2. Match the atom with the number of lone pairs of electrons it will commonly possess in a Lewis structure: Carbon. - 0. Daily interest compounding means there will be a difference between the annual percentage rate and the annual percentage yield. Knowing how to calculate the APY helps ensure you’re getting the best deal with your banking. When you take out ...Which of the following describes compounds a. are composed of elements that join in a specific ratio according to their masses b. are composed of two or more elements that are physically combined c. are random combinations of elements d. have the same characteristic properties as the elements that form them Study with Quizlet and memorize flashcards containing terms like Identify the compound with covalent bonds. A) CH4 B) Kr C) KBr D) K E) NaCl, Which of the following contains BOTH ionic and covalent bonds? A) CaBr2 B) COS C) BaSO4 D) SF6 E) None of the above contain both ionic and covalent bonds., An ionic bond is best described as A) the sharing of electrons. B) the transfer of electrons from ...Study with Quizlet and memorize flashcards containing terms like A substance, natural or synthetic, that is intended to prevent, alleviate, or cure an illness is called a(n) ., Organic chemistry is the study of compounds that _____., How many covalent bonds are typically formed by a neutral atom of each of the following elements?N forms_____ bonds.H forms_____ bonds.O forms _____bonds. and more. 7) Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound? CH3 H3C OH HO 8) Label each asymmetric carbon in the compound below as R or S. OH CH3 9) Label each asymmetric carbon in the compound below as R or S. OH H CH3 OH H CH3 10) Label each assymetric carbon in the compound ... For instance, positively charged sodium ions and negatively charged chloride ions attract each other to make sodium chloride, or table salt. Table salt, like many ionic compounds, doesn't consist of just one sodium and one chloride ion; instead, it contains many ions arranged in a repeating, predictable 3D pattern (a crystal). 1 Calcium fluoride, CaF2, is an example of _____. a metallic compound a polar covalent compound a covalent compound an ionic compound d Which of the following describes the reason for the following application of metals? long wires acting to carry power are strong but can be bent are shiny More than one of the answers are correct.Which of the following statements correctly describes a compound? I. It can be broken down into a simpler type of matter by chemical means. II. It has unique properties that are different from the properties of its individual elements. III. It is composed of atoms of two or more elements that bond together. IV. It is composed of atoms of the ...The option which correctly describes a mixture is: D. The particles have no set ratio for how to combine, and they can be separated by physical means. A mixture can be defined as a combination of two (2) or more substances which are present in varied proportion (unfixed ratios).Also, a mixture can be visibly seen with our naked eyes and …Math Algebra Which of the following best describes the differences between simple and compound interest? a. simple interest is easier to calculate than compound interest b. simple interest earns interest on the previous interest earned only c. compound interest earns interest on the principal plus any previous interest earned d. compound ...Study with Quizlet and memorize flashcards containing terms like Explain why the symbol for an atom of the element oxygen and the formula for a molecule of oxygen differ., Write the molecular and empirical formulas of the following compounds: (a) Figure A shows a carbon atom that forms two, separate double bonds with two oxygen atoms. (b) Figure B …Which of the following best describes a compound? A compound can be separated into its elements. When chemical bonds form, the valence electrons in an atom can undergo …A compound is a pure substance formed by the chemical combination of two or more different elements. A compound may be splitted into simpler substances by chemical reactions, and has different properties to those of the elements that form it. The composition of a compound is fixed: every piece of a compound has the same kind of …Jan 20, 2021 · The correct option that describes a compound is: "The atoms can only combine in fixed ratios, and they can only be separated by a chemical change."Explanation: A compound is defined as a substance composed of two or more different types of elements that are chemically combined in fixed proportions. Classify each of the following substances as an element, a compound, a homogeneous mixture, or a heterogeneous mixture. Sucrose, which is commonly-known as "table sugar" (C 12 H 22 O 11) 2.1: Classifications of Matter is shared under a not declared license and was authored, remixed, and/or curated by LibreTexts.The simplest Organic compounds are made up of only Carbon and Hydrogen atoms only. Compounds of Carbon and Hydrogen only are called Hydrocarbons. Alkanes. The ...Which of the following statements correctly describe covalent compounds? Select all that apply. Most of the compounds that we come in contact with are covalent compounds. Covalent compounds are formed by sharing electrons between atoms. Nitrogen, N2, is a covalent compound. Terms in this set (73) Which of the following species are the two products of respiration? Water. Carbon dioxide. mixture. Physical combination of two or more species. pure substance. Form of matter with a definite composition. Place the layers of Earth's atmosphere in the correct order, starting with the layer that is closest to Earth at the ...Correct option is C) Molecules that are optical isomers are called enantiomers. Enantiomers have identical chemical and physical properties, except their effect on plane polarised light and reaction with other chiral molecules. Here, CH 3CH(OH)COOH is optically active.Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe the structural features and reactivity of compounds containing a C-Z σ bond, where Z is a heteroatom such as oxygen? (Select all that apply., Which of the following are common structural features of organic compounds? (Select all that apply.), What is the general structure for ...Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe the structural features and reactivity of compounds containing a C-Z σ bond, where Z is a heteroatom such as oxygen? (Select all that apply., Which of the following are common structural features of organic compounds? (Select all that apply.), What is the general structure for ...Which of the following best describes a compound? a) a compound cannot be separated into its element. b) a compound can be separated into elements. c) …Calcium fluoride, CaF2, is an example of _____. a metallic compound a polar covalent compound a covalent compound an ionic compound d Which of the following describes the reason for the following application of metals? long wires acting to carry power are strong but can be bent are shiny More than one of the answers are correct. Which of the following gives the best explanation for why a substance does not conduct electricity? A. The bonding in the substance is not ionic. B. The bonding model in the substance does not have free electron s. C. The bonding model does not have ions which are free to move, or free electrons . D. The bonding model does not have ions or free ...Only 1. Match the molecular geometry and the number of lone pairs of electrons on the central atom: Bent geometry. - 0. - Only 1. - 1 or 2. 1 or 2. Match the atom with the number of lone pairs of electrons it will commonly possess in a Lewis structure: Carbon. - 0. Choose all answers that apply. The compound is ionic. The compound would be expected to be a solid at room temperature and pressure. If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. | If the compound dissolved in water it would be a non-electrolyte. Show transcribed image text. The simplest Organic compounds are made up of only Carbon and Hydrogen atoms only. Compounds of Carbon and Hydrogen only are called Hydrocarbons. Alkanes. The ...Terms in this set (73) Which of the following species are the two products of respiration? Water. Carbon dioxide. mixture. Physical combination of two or more species. pure substance. Form of matter with a definite composition. Place the layers of Earth's atmosphere in the correct order, starting with the layer that is closest to Earth at the ...Jan 4, 2013 ... While in mixtures proportions of constituents are highly variable, in compounds they are not. If a compound is molecular, all it's molecules are ...Many chemical reactions can be classified as one of five basic types. Having a thorough understanding of these types of reactions will be useful for predicting the products of an unknown reaction. The five basic types of chemical reactions are combination, decomposition, single-replacement, double-replacement, and combustion.Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe ionic bonding?, When the elements Mg and Cl form an ionic bond, Mg loses __ electron(s) from the 3s orbital to form the Mg2+ cation. Cl gains __ electron(s) in the 3p orbital to form the Cl- anion. Since the total number of electrons lost always equals the total number of ...Power plants release the majority of sulfur dioxide and much of the nitrogen oxides when they burn fossil fuels, such as coal, to produce electricity. In addition, the exhaust from cars, trucks, and buses releases nitrogen oxides and sulfur dioxide into the air. These pollutants cause acid rain. Acid Rain is Caused by Reactions in the Environment.The compound would conduct electricity if molten. The compound is ionic. The compound is molecular. Which of the following describes the compound KBr? Choose all answers that apply. | The compound would be expected to have a relatively low melting point. If the compound dissolved in water it would be a strong electrolyte.Mar 14, 2023 ... VOCs that are non-reactive or of negligible reactivity to form ozone under these conditions are exempted from the definition of VOCs used by EPA ...Chemistry questions and answers. Which of the following best describes if a solvent will dissolve a compound. 1. the molecular weight of the solvent is similar to that of the compound 2. the functional group of the solvent and the compound are the same 3. the boiling point of the solvent and compound are similar 4.the dominant inter-molecular ...Study with Quizlet and memorize flashcards containing terms like Rank the states of matter based on increasing strength of intermolecular forces, placing the state whose intermolecular forces are weakest at the top., Which of the following properties of liquids are influenced by intermolecular forces? Select all that apply., Which of the following statements correctly describe the surface ...Explain your answer. The model does not represent a compound because it shows two atoms of the same element combined. To be a compound, the model would need to contain atoms of different elements, represented by different-colored balls. H is a chemical. and H2 is a chemical. See Answer. Question: Consider the following alkyl chlorides. Which of the following graphs best describes how the rate of reaction between compound D and Br changes as a function of the concentration of the bromide ion? Question Image: А B C D CI . CI CI Answer Image: d) R A T E b) R A A T E E T E [Br] [Br] [Br] [Br] ing O E Answer Image: a ...26, 26, 32. An isotope with 15 protons and 17 neutrons will have which symbol? 13. P. 15. An imaginary element zXa consists of two isotopes having masses of 100.0 amu and 102.0 amu. A sample of zXa was found to contain 75.0% of the zX100 isotope and 25.0% of the zX102. Calculate the atomic weight of zXa.Answer 4 people found it helpful PrincessTeja report flag outlined Answer: A compound is defined as a chemical substance in which two or more different elements …Which of the following describes the compound PCl5? Choose all answers that apply. A. The compound is molecular. B. The compound would be expected to have a relatively low melting point. C. The compound would be expected to have a relatively high melting point.Study with Quizlet and memorize flashcards containing terms like Water's surface tension and heat storage capacity is accounted for by its, Which of the following statements best describes a compound?, Which of the following best describes the atomic number of an atom? and more.Which statement best describes a compound? a. a mixture of atoms b. a mixture of more than one element c. a material that is made up of a combination of atoms bonded together d. a material that is made up of a single type of atom e. none of the above; Which of the following best describes the substance XeF_4? a. Element. b. Compound. c.The molecule possesses enantiotopic hydrogens. Which of the following statements describes the compound shown below? Y O The mirror image of this molecule is its enantiomer. O It is meso. O Its asymmetric center possesses the R configuration. O It is achiral. The molecule possesses enantiotopic hydrogens. BUY.Study with Quizlet and memorize flashcards containing terms like Water's surface tension and heat storage capacity is accounted for by its, Which of the following statements best describes a compound?, Which of the following best describes the atomic number of an atom? and more.Choose all answers that apply. The compound is ionic. The compound would be expected to be a solid at room temperature and pressure. If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. | If the compound dissolved in water it would be a non-electrolyte. Show transcribed image text. Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe organic compounds?, Which of the following defines an organic compound?, Carbon has the ability to catenate, or form long, stable ___ of carbon atoms. This is because C-C bonds have relatively ____ bond strength and short bond lengths. and more.1. Correctly order the steps followed in writing the formula of an ionic compound containing a polyatomic ion. 1. Identify the formulas and charges of the cation and anion. 2. Determine how many of each ion type is needed to make a neutral compound. 3. Place the cation first in the formula, followed by the anion.Terms in this set (73) Which of the following species are the two products of respiration? Water. Carbon dioxide. mixture. Physical combination of two or more species. pure substance. Form of matter with a definite composition. Place the layers of Earth's atmosphere in the correct order, starting with the layer that is closest to Earth at the ...Choose all answers that apply. The compound is ionic. The compound would be expected to be a solid at room temperature and pressure. If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. | If the compound dissolved in water it would be a non-electrolyte. Show transcribed image text. Study with Quizlet and memorize flashcards containing terms like An ionic compound will dissolve when the attraction between the _____ molecules and the ions is greater than the attraction between the _____ themselves., An electric current requires the movement of _____ particles, which could be electrons or ions. A solid ionic substance does not conduct an electric current because the ions ...Target-focused compound libraries are collections of compounds which are designed ... This article describes examples of each of these design approaches and ...Solusi 1. Oxygen has an atomic number of 8 and its configuration is 2, 6. For an atom to attain the octet structure it must have 8 electrons in its outermost shell, this implies that oxygen needs two more electrons to attain stability. In order to attain the octet structure, two oxygen atoms will donate two electrons each and share these ...The option which correctly describes a mixture is: D. The particles have no set ratio for how to combine, and they can be separated by physical means. A mixture can be defined as a combination of two (2) or more substances which are present in varied proportion (unfixed ratios).Also, a mixture can be visibly seen with our naked eyes and …Jan 20, 2021 · The correct option that describes a compound is: "The atoms can only combine in fixed ratios, and they can only be separated by a chemical change."Explanation: A compound is defined as a substance composed of two or more different types of elements that are chemically combined in fixed proportions. Mar 4, 2021 · These compounds are typically found in living organisms and are essential to the growth and survival of living systems. Examples of organic compounds include carbohydrates, lipids, proteins, and nucleic acids.Organic compounds play a critical role in many biological processes and are the basis of many important industries such as agriculture ... 7) Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound? CH3 H3C OH HO 8) Label each asymmetric carbon in the compound below as R or S. OH CH3 9) Label each asymmetric carbon in the compound below as R or S. OH H CH3 OH H CH3 10) Label each assymetric carbon in the compound ...Study with Quizlet and memorize flashcards containing terms like When they can be easily denatured, distorted, and/or degraded by mild changes to the environment, compounds are called:, What term is used to describe proteins losing their 3D structure as a consequence of changes in the environmental conditions such as excessive heat or salt? A. …Organic Compounds, Quiz 4.8 (17 reviews) Gina wants to use models to better understand how the types of bonds in a molecule relate to the presence of geometric isomers. Which model would be most helpful in her research? a) the space-filling model b) the structural formula c) the molecular formula d) the ball-and-stick model Click the card to flip 👆Question: Which of the following describes an enzyme? O A catalyst for a chemical reaction O A compound that stores energy within its chemical bonds O A compound that is changed into a product during a chemical reaction The end product of a chemical reaction. There are 3 steps to solve this one.Chemistry questions and answers. Which of the following correctly describes chemical compounds? (Select all answers that apply.) A chemical compound can be represented by a chemical formula using elemental symbols and subscripts indicating the number of atoms of each element. A chemical compound is a physical combination of two or more elements.Which of the following describes a compound, skyrim anniversary edition load order, walgreens pharmacy on airport road
Question: Which of the following correctly describes a compound? a. The atoms are bonded together, and the compound has different physical and chemical properties than the individual.... Which of the following describes a compound
litter robot getting stuckChemical compound, any substance composed of identical molecules consisting of atoms of two or more chemical elements. All the matter in the universe is composed of the atoms of more than 100 different chemical elements, which are found both in pure form and combined in chemical compounds.A binary ionic compound is a compound composed of a monatomic metal cation and a monatomic nonmetal anion. The metal cation is named first, followed by the nonmetal anion as illustrated in Figure 4.5.1 4.5. 1 for the compound BaCl 2. The word ion is dropped from both parts. Figure 4.5.1 4.5. 1 Naming BaCl2 B a C l 2.Inorganic chemical compounds can be broadly classified into two groups: ionic compounds and molecular compounds. The structure of all ionic compounds is an extended three-dimensional array of alternating positive and negative ions. Since ionic compounds do not take the form of individual molecules, they are represented by …Chemistry. Chemistry questions and answers. The compound, CH3NH2, contains a C-N bond. Which of the following best describes the charge on the nitrogen atom in this compound? And why? a) -1 b) +1 c) Slightly Positive d) Slightly Negative e) Uncharged.Which of the following describes a compound? (2 points) A single type of atom. A particle that is smaller than an atom. Two or more types of atoms chemically bonded together. Two unrelated atoms that are not chemically bonded. Two or more types of atoms chemically bonded togetherWhich of the following are pure substances? Explain.(a) Calcium chloride, used to melt ice on roads, consists of twoelements, calcium and chlorine, in a fixed mass ratio.(b) Sulfur consists of sulfur atoms combined into octatomicmolecules.(c) Baking powder, a leavening agent, contains 26% to 30%sodium hydrogen carbonate and 30% to 35% calcium …A compound is a pure substance formed by the chemical combination of two or more different elements. A compound may be splitted into simpler substances by chemical reactions, and has different properties to those of the elements that form it. The composition of a compound is fixed: every piece of a compound has the same kind of …Which of the following describes compounds a. are composed of elements that join in a specific ratio according to their masses b. are composed of two or more elements that are physically combined c. are random combinations of elements d. have the same characteristic properties as the elements that form themQuestion: Spermine (structure shown) is a compound isolated from sperm. Which of the following statements correctly describes an aqueous solution of spermine? NH2(CH2)3NH(CH2)4NH(CH2)3NH2 Question 2 options: A) The hydroxide ion concentration in the solution would be greater than that in pure water.Study with Quizlet and memorize flashcards containing terms like 5-3, Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound?, Which of the following structures are identical to the structure in the box? and more. Study with Quizlet and memorize flashcards containing terms like A substance, natural or synthetic, that is intended to prevent, alleviate, or cure an illness is called a(n) ., Organic chemistry is the study of compounds that _____., How many covalent bonds are typically formed by a neutral atom of each of the following elements?N forms_____ bonds.H forms_____ bonds.O forms _____bonds. and more. a. 1.5 x 10². When the numbers 4.2 x 10² and 8.4 x 10¹ are multiplied, the exponent of the result, expressed in proper scientific notation is. a. 1. b.2. c. 3. d. 4. d. 4. As the temperature of a gas is increased, the average kinetic energy of its molecules. A) remains the same.This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. Question: Which of the following correctly describe the molecular mass of a compound? Click the answer you think is right. The sum of the atomic masses of all the elements of a compound The sum of the atomic numbers of a ...User: Which of the following describes the formation of a compound sentence? Weegy: A compound sentence is formed by joining two simple sentences with a comma and a coordinating conjunction. Score 1 User: Whats a claim? Weegy: A claim is: a statement essentially arguable, but used as a primary point to support or prove an …provides a cell membrane that regulates the interaction between the cell and the environment. Which of the following carbon compounds helps form muscles and bone and controls cell processes? proteins. Which of the following statements BEST describes the importance of carbon in the cell? Carbon provides structure and affects the function of a cell. Which of the following describes the formation of a compound sentence? A. Two independent clauses are joined by a comma and a conjunction. B. Two dependent clauses are joined by a semicolon. C. A dependent clause is connected to an independent clause with a semicolon. D. A dependent clause is connected to an independent clause with a comma.This efficiency is represented by the percentage yield which is the amount of product recovered divided by the amount which should be vielded represented as a percent. 100% means the mass recovered equals the mass you expect based on mass of reactant and stoichiometry Steps 1 Calculate the moles of 4-aminophenol used in reaction 2.Expert Answer. 1. Which of the following correctly describes one of the differences between compounds and mixtures? (a) Compounds contain more than one element but mixtures do not. (b) Compounds have a constant composition but mixtures do not. (c) It is easier to separate the elements in a compound than it is to separate the elements in a …Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe the structural features and reactivity of compounds containing a C-Z σ bond, where Z is a heteroatom such as oxygen? (Select all that apply., Which of the following are common structural features of organic compounds? (Select all that …Which of the following describes the compound AgCH3CO0? Choose all answers that apply. The compound is ionic. ) If the compound dissolved in water it would be a non-electrolyte. ) If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. ) The compound would be expected to be a solid at room temperature and ...Identify identical compounds. A and C. What is the relative priority of the CH3 group in the following compound? 3. E configuration. the highest priority groups are on the opposite side of the double bond. trans configuration. the H atoms are bonded on the opposite side of the C=C. Stereoisomers. Which of the following correctly describes a compound? (4 points) The atoms are chemically bonded together, and they retain their individual physical and chemical properties. The atoms are not chemically bonded, and there is no set ratio for how the atoms can combine together.Study with Quizlet and memorize flashcards containing terms like Which of the following is the branch of chemistry concerned with energy changes? A. Cytochemistry B. Inorganic chemistry C. Organic chemistry D. Thermodynamics, Work in the cell or in the physical world can only be done with expenditure of __________; it is defined as the capacity to do …Ionic Compound Structure. The structure of an ionic compound depends on the relative sizes of the cations and anions. Ionic compounds include salts, oxides, hydroxides, sulphides, and the majority of inorganic compounds. Ionic solids are held together by the electrostatic attraction between the positive and negative ions.Which of the following describes compounds a. are composed of elements that join in a specific ratio according to their masses b. are composed of two or more elements that are physically combined c. are random combinations of elements d. have the same characteristic properties as the elements that form them Organic chemistry is the study of. Compounds containing carbon and hydrogen. A structural or condensed structural formula will give more information about blank in the molecule then the simple molecular formula. The order in which Adams are bonded. Which of the following statements correctly describes Easters.Which of the following statements best describes a compound? a. A compound is a pure element. b. A compound contains two or more different elements in a fixed ratio. c. A …1 millimeter = __________ meter. 0.001. Perform the following calculation and give the answer with the correct number of significant figures. 35,920 ÷ 172. 209. Gasoline has a density of 0.740 g/mL. If you have 328 grams of gasoline, what is the volume in milliliters?Lipid, any of a diverse group of organic compounds including fats, oils, hormones, and certain components of membranes that are grouped together because they do not interact appreciably with water. Learn more about the structure, types, and …Chemical compounds consist of two or more chemical elements. Visit HowStuffWorks to learn all about chemical compounds. Advertisement Chemical compounds are substances that form when two or more elements are joined together. Most of the ato...A compound is a substance that is composed of two or more different atoms. It can be described by the following options: 1. Components are in a fixed ratio: This means that the elements in a compound are combined in specific proportions. For example, water (H2O) always consists of two hydrogen atoms and one oxygen atom. 2.Question: Which of the following describes what happens to the solubility of a slightly soluble ionic compound when common ion is added to the solution? The solubility of the ionic compound is increased The ionic compound diesolves more rapidly. More of the lonic compound dissolves. There is no effect on the solubility of the ionic compound.Study with Quizlet and memorize flashcards containing terms like Which of the following statements is TRUE of an atom? You can see the parts of an atom with a typical lab microscope. There is no other particle in matter that is smaller than an atom. All atoms contain the same number of protons, neutrons, and electrons. A grain of salt contains …Study with Quizlet and memorize flashcards containing terms like The term _____ is used to describe how well the electron cloud around an atom responds to changes in its electronic environment. A larger atom will hold its valence electrons _____ tightly than a smaller atom and will therefore have a greater response to the presence of a charged or polar particle nearby., Which of the following ...Which of the following describes a heterogeneous mixture? carbon monoxide (CO) ... It may bond with sulfurto form the compound BeS. Beryllium is a(n) _____. element.Cultism is defined as the practices and devotions of a cult. It is a noun used to describe a cult, a religion, or a religious sect that is considered extreme or false and typically follows a charismatic leader.d.spiro bicyclic. 2.Which of the following describes the compound below? A. bridged bicyclic. B. spiro bicyclic. C. fused bicyclic. D. bridged tricyclic. 3.Choose the IUPAC name that best describes the following molecule. a.spiro [5.2]octane. b.bicyclo [3.2.1]octane. Which statement best describes a compound? a. a mixture of atoms b. a mixture of more than one element c. a material that is made up of a combination of atoms bonded together d. a material that is made up of a single type of atom e. none of the above; Which of the following best describes the substance XeF_4? a. Element. b. Compound. c.Classification of Matter. 3.2K plays. 8th - 10th. 20 Qs. Classifying Matter. 8.3K plays. 9th - 10th. Compounds and Mixtures quiz for 5th grade students. Find other quizzes for Chemistry and more on Quizizz for free!Choose all answers that apply. The compound is ionic. The compound would be expected to be a solid at room temperature and pressure. If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. | If the compound dissolved in water it would be a non-electrolyte. Show transcribed image text.Study with Quizlet and memorize flashcards containing terms like The word atom is derived from a word in which language? a. Arabic b. Greek c. Hebrew d. Latin, Which of the following statements describe a compound? a. A compound is a pure substance. b. A compound obeys the law of constant composition. c. both a and b d. neither a nor b, Which of the following statements describe a mixture? a ...7) Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound? CH3 H3C OH HO 8) Label each asymmetric carbon in the compound below as R or S. OH CH3 9) Label each asymmetric carbon in the compound below as R or S. OH H CH3 OH H CH3 10) Label each assymetric carbon in the compound ... provides a cell membrane that regulates the interaction between the cell and the environment. Which of the following carbon compounds helps form muscles and bone and controls cell processes? proteins. Which of the following statements BEST describes the importance of carbon in the cell? Carbon provides structure and affects the function of a cell. Which of the following correctly describes a compound? a. The atoms are bonded together, and the compound has different physical and chemical properties than the individual elements. b. The atoms have no set ratio for how the atoms can combine, and they are not chemically bonded together. c. User: Which of the following describes the formation of a compound sentence? Weegy: A compound sentence is formed by joining two simple sentences with a comma and a coordinating conjunction. Score 1 User: Whats a claim? Weegy: A claim is: a statement essentially arguable, but used as a primary point to support or prove an …Study with Quizlet and memorize flashcards containing terms like Write the chemical formula of the ionic compound that is composed of Ti^4+ and O^-2 ions., To represent an ion, the charge of the ion is written as a right _______ next to the element symbol. If the charge is a number other than one, the number is usually written ________ the positive or negative sign., Which of the following ...What describes a compound? 1) In chemistry, a compound is a substance that results from a combination of two or more different chemical element s, in such a way that the atom s of the different elements are held together by chemical bonds that are difficult to break. The smallest unbreakable unit of a compound is called a molecule .Define compound adjective: the definition of compound adjective is a phrase or set of words taken as a unit to modify a noun. In summary, a compound adjective is, an adjective that modifies a noun. made up of more than one word. usually hyphenated.Question: Question 26 Choose the correct answer: Which of the following best describes how compound interest works? [1 Mark] (a) Interest is calculated only on previously earned interest (b) The compound interest rate increases as the term progresses (c) Interest is calculated only at the end of the term (d) The compound interest rate increases as the …Directions: Study each picture below. In the spaces provided, identify how many atoms, elements, molecules, and compounds there are.Which of the following describes the formation of a compound sentence? A. Two independent clauses are joined by a comma and a conjunction. B. Two dependent clauses are joined by a semicolon. C. A dependent clause is connected to an independent clause with a semicolon. D. A dependent clause is connected to an independent clause …This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. See Answer. Question: - Part A Which of the following compounds is correctly classified? View Available Hint (s) O CH3COCH3, organic, hydrocarbon O CH2Cl2, ionic CaCO3, organic CH3CH2CH3, organic, hydrocarbon …Study with Quizlet and memorize flashcards containing terms like The word atom is derived from a word in which language? a. Arabic b. Greek c. Hebrew d. Latin, Which of the following statements describe a compound? a. A compound is a pure substance. b. A compound obeys the law of constant composition. c. both a and b d. neither a nor b, Which of the following statements describe a mixture? a ...question 2 people found it helpful saimaparvezVT report flag outlined The statement describes a compound: "two or more types of atoms chemically bonded together". The correct answer would be an option (C). What is the compound? Compounds are pure molecules made up of two or more separate elements ' atoms.SmartBook 1. Which of the following statements correctly describe covalent compounds? Select all that apply. Click the card to flip 👆. Most of the compounds that we come in contact with are covalent compounds. Covalent compounds are formed by sharing electrons between atoms. Covalent compounds contain covalent bonds.provides a cell membrane that regulates the interaction between the cell and the environment. Which of the following carbon compounds helps form muscles and bone and controls cell processes? proteins. Which of the following statements BEST describes the importance of carbon in the cell? Carbon provides structure and affects the function of a cell.A) Relatively few people on this planet are lactose intolerant. B) The ability to hydrolyze lactose would be equally beneficial to all human populations. C) Lactose tolerance has evolved independently in multiple different human populations. D) Lactose intolerance refers to a person's inability to produce the sugar lactose.Study with Quizlet and memorize flashcards containing terms like Atoms bond in order to attain a full _____ level or shell of electrons. Elements in period 2 seek a total of _____ such electrons while period 1 elements such as hydrogen seek a total of _____., True or false: All of the electrons in a many-electron atom can participate in covalent bonding., Which of …Which of the following correctly describes chemical compounds? (Select all answers that apply.) A chemical compound can be represented by a chemical formula using elemental symbols and subscripts indicating the number of atoms of each element. A chemical compound is a physical combination of two or more elements.... describes how the criteria specified in paragraphs (f), (g), and (h) of this ... following information to the health professional, employee, or designated ...Which of the following best describes a compound? A compound can be separated into its elements. When chemical bonds form, the valence electrons in an atom can undergo …Study with Quizlet and memorize flashcards containing terms like Which describes a series of chemical reactions that inactivate a drug by converting it to a water-soluble compound?, Which will cause drugs that are taken orally to be absorbed more quickly?, Which describe the effect of a drug that is mainly limited to the area where it is applied or enters the …A compound sentence contains two independent clauses—groups of words that can function as complete sentences. The independent clauses in a compound sentence must be separated by a semicolon or by a comma and a coordinating conjunction. Semicolon. A semicolon can be used to create a compound sentence. A compound sentence is …Which of the following describes compounds a. are composed of elements that join in a specific ratio according to their masses b. are composed of two or more elements that are physically combined c. are random combinations of elements d. have the same characteristic properties as the elements that form them Directions: Study each picture below. In the spaces provided, identify how many atoms, elements, molecules, and compounds there are.Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe ionic bonding?, When the elements Mg and Cl form an ionic bond, Mg loses __ electron(s) from the 3s orbital to form the Mg2+ cation. Cl gains __ electron(s) in the 3p orbital to form the Cl- anion. Since the total number of electrons lost always equals the total number of ...The next statement that best describes a compound or inorganic substance is the option that indicates that it is a compound without molecules containing carbon.. In the attached image some examples of inorganic compounds are named.. Inorganic chemical compound. Inorganic chemical compound is called all those that are formed …Expert Answer. Option D is correct When a soluble ionic compound is dissolved in water then the process which goes on is that the ions ar …. QUESTION 2 Which of the following best describes what happens as a soluble ionic compound dissolves in water? O The ionic compound reacts with the water and falls apart into individual atoms O lonic ...Figure 3.1.3 3.1. 3: The Three-Dimensional Structures of Water, Ammonia, and Methane. (a) Water is a V-shaped molecule, in which all three atoms lie in a plane. (b) In contrast, ammonia has a pyramidal structure, in which the three hydrogen atoms form the base of the pyramid and the nitrogen atom is at the vertex.Classification of Matter. 3.2K plays. 8th - 10th. 20 Qs. Classifying Matter. 8.3K plays. 9th - 10th. Compounds and Mixtures quiz for 5th grade students. Find other quizzes for Chemistry and more on Quizizz for free! The Gibbs free energy for the following reaction Na 2 SO 4 + 10 H 2 O ---- > Na 2 SO 4 * 10 H 2 O can be described by ΔG = ΔH - TDS = -77.8 kJ/mol - T (-261 J/mol*K) Based on this equation, it can be estimated that the reaction reverses at 298 K or 25 o C (ΔG =0). The drying process itself is slightly exothermic (ΔH for the process is negative) …26, 26, 32. An isotope with 15 protons and 17 neutrons will have which symbol? 13. P. 15. An imaginary element zXa consists of two isotopes having masses of 100.0 amu and 102.0 amu. A sample of zXa was found to contain 75.0% of the zX100 isotope and 25.0% of the zX102. Calculate the atomic weight of zXa.Study with Quizlet and memorize flashcards containing terms like Which statement best describes an independent variable?, A student conducts an experiment to determine how the addition of salt to water affects the density of the water. The student fills 3 beakers with equal amounts of water. He then adds 1 cup of salt to the first beaker, 2 cups of salt to …Atoms of the elements form bonds to combine and make up a molecule of the compound. The compound contains a uniform distribution of these molecules. A ...Study with Quizlet and memorize flashcards containing terms like Which of the following are a pure substance? A. Solution B. Compounds C. Homogeneous Mixture D. Colloids, Which of the following is NOT a pure substance? A. Milk B. Oxygen C. Water D. Carbon Dioxide, A substance that is only made up of one kind of atom is a(an) A. Compound B. …Study with Quizlet and memorize flashcards containing terms like Explain why the symbol for an atom of the element oxygen and the formula for a molecule of oxygen differ., Write the molecular and empirical formulas of the following compounds: (a) Figure A shows a carbon atom that forms two, separate double bonds with two oxygen atoms. (b) Figure B shows a hydrogen atom which forms a single ... 7) Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound? CH3 H3C OH HO 8) Label each asymmetric carbon in the compound below as R or S. OH CH3 9) Label each asymmetric carbon in the compound below as R or S. OH H CH3 OH H CH3 10) Label each assymetric carbon in the compound ...1. Correctly order the steps followed in writing the formula of an ionic compound containing a polyatomic ion. 1. Identify the formulas and charges of the cation and anion. 2. Determine how many of each ion type is needed to make a neutral compound. 3. Place the cation first in the formula, followed by the anion. A. the presence of a solid proves that a chemical change has occurred B. the presence of two colors proves that a chemical change has occurred C. The absence of gas bubbles proves that no change has occurred D. It is impossible to tell because it is unknown whether the solid formed during the reaction and more.Study with Quizlet and memorize flashcards containing terms like Which of the following statements about organic compounds is FALSE?, Which of the following best describes molecules related as conformational isomers?, Which bonding pattern is NOT typical of carbon atoms in organic compounds? and more.Math Algebra Which of the following best describes the differences between simple and compound interest? a. simple interest is easier to calculate than compound interest b. simple interest earns interest on the previous interest earned only c. compound interest earns interest on the principal plus any previous interest earned d. compound ...User: Which of the following describes the formation of a compound sentence? Weegy: A compound sentence is formed by joining two simple sentences with a comma and a coordinating conjunction. Score 1 User: Whats a claim? Weegy: A claim is: a statement essentially arguable, but used as a primary point to support or prove an …. Sapura recreational weed dispensary coldwater reviews, craigslist lexington ky com