provides a cell membrane that regulates the interaction between the cell and the environment. Which of the following carbon compounds helps form muscles and bone and controls cell processes? proteins. Which of the following statements BEST describes the importance of carbon in the cell? Carbon provides structure and affects the function of a cell.E. The compound would be a good conductor of heat and electricity. Which of the following describes the compound PCl5? Choose all answers that apply. A. The compound is molecular. B. The compound would be expected to have a relatively low melting point. C.answer answered Which of the following statements correctly describes a compound? I. It can be broken down into a simpler type of matter by chemical means. …88) Which of the following statements about the noble gases is incorrect? A) All have very stable electron arrangements. B) They are the most reactive of all gases. C) All have 8 valence electrons. D) All exist in nature as individual atoms rather than molecular form. 89) Which of the following statements concerning double covalent bonds is ...ELEMENTS AND COMPOUNDS. Elements and Compounds. 1-1. Which of the following correctly describes one of the differences between compounds and mixtures? (a) compounds contain more than one element but mixtures do not (b) compounds have a constant composition but mixtures do not The compound would be expected to have a relatively low melting point. The compound is molecular. The compound is ionic. 3 Which of the following describes the compound Fe 2 (SO 4) 3? Choose all answers that apply. If the compound dissolved in water it would be a non-electrolyte. If the compound dissolved in water it would be a strong electrolyte.Cultism is defined as the practices and devotions of a cult. It is a noun used to describe a cult, a religion, or a religious sect that is considered extreme or false and typically follows a charismatic leader.The correct option is C. It is formed by bonding of two or more elements. An element is defined as the simplest substance that cannot be broken down using chemical methods. A compound on the other hand is a substance formed when two or more chemical elements are bonded together. A molecule is formed by bonding of two or more atoms of the same ...Which of the following amino acids is it? a) Alanine b) Valine c) Glycine d) Cysteine Question 3. In nature, glucose mostly exists in the cyclic (rather than linear) form. True or false? a) True b) False Question 4. Which of the following terms correctly describes a compound featuring more than one double bond?Power plants release the majority of sulfur dioxide and much of the nitrogen oxides when they burn fossil fuels, such as coal, to produce electricity. In addition, the exhaust from cars, trucks, and buses releases nitrogen oxides and sulfur dioxide into the air. These pollutants cause acid rain. Acid Rain is Caused by Reactions in the Environment.Ionic Compound Structure. The structure of an ionic compound depends on the relative sizes of the cations and anions. Ionic compounds include salts, oxides, hydroxides, sulphides, and the majority of inorganic compounds. Ionic solids are held together by the electrostatic attraction between the positive and negative ions.Which of the following describes what happens to the solubility of a slightly soluble ionic compound when a common ion is added to the solution? There is no effect on the solubility of the ionic compound. More of the ionic compound dissolves. The solubility of the ionic compound is reduced. The solubility of the ionic compound is increased. BUY.Describe and define a compound-complex sentence. A compound-complex sentence has 2 or more independent clauses and at least 1 dependent clause. True or false: This is an example of a compound-complex; Before I went to the movies, I finished my homework, and it took forever. True. True or false: This is an example of a complex sentence; I do not ...When you mix an acid with an alkali, the compounds produce salt and water, as described by HyperPhysics, hosted by Georgia State University. Chemical reactions during which acid and base properties of compounds are neutralized are called ne...Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe organic compounds?, Which of the following defines an organic compound?, Carbon has the ability to catenate, or form long, stable ___ of carbon atoms. This is because C-C bonds have relatively ____ bond strength and short bond lengths. and more. Chemical compound, any substance composed of identical molecules consisting of atoms of two or more chemical elements. All the matter in the universe is composed of the atoms of more than 100 different chemical elements, which are found both in pure form and combined in chemical compounds.Sodium chloride is an ionic compound made up of sodium ions and chloride ions in a crystal lattice. Image credit: Wikipedia Commons, public domain. Atoms are electrically neutral because the number of protons, which carry a 1+ charge, in the nucleus of an atom is equal to the number of electrons, which carry a 1- charge, in the atom.Study with Quizlet and memorize flashcards containing terms like Which of the following statements about organic compounds is FALSE?, Which of the following best describes molecules related as conformational isomers?, Which bonding pattern is NOT typical of carbon atoms in organic compounds? and more. Question: Which of the following describes an enzyme? O A catalyst for a chemical reaction O A compound that stores energy within its chemical bonds O A compound that is changed into a product during a chemical reaction The end product of a chemical reaction. There are 3 steps to solve this one.Which of the following statements best describes a compound? a. A compound is a pure element. b. A compound contains two or more different elements in a fixed ratio. c. A compound is exemplified by sodium. d. A compound is a solutionConjugation of a double bond to a carbonyl group transmits the electrophilic character of the carbonyl carbon to the beta-carbon of the double bond. These conjugated carbonyl are called enones or α, β unsaturated carbonyls. A resonance description of this transmission is shown below. From this formula it should be clear that nucleophiles may ...Study with Quizlet and memorize flashcards containing terms like A piece of sodium metal can be described as A. a pure substance and a compound. B. an impure substance that is reactive. C. an impure substance that is unreactive. D. a pure substance and an element., Which statement describes an extensive property of matter? A. It changes with the color …Study with Quizlet and memorize flashcards containing terms like Water's surface tension and heat storage capacity is accounted for by its, Which of the following statements best describes a compound?, Which of the following best describes the atomic number of an atom? and more.Cultism is defined as the practices and devotions of a cult. It is a noun used to describe a cult, a religion, or a religious sect that is considered extreme or false and typically follows a charismatic leader.Study with Quizlet and memorize flashcards containing terms like Which of the following correctly defines an organic compound?, Carbon forms covalent bonds in all its compounds due to its _____. Select all the options that complete this sentence correctly., Carbon is able to form a wide variety of stable chain, ring, and branched compounds. Which factors contribute to this behavior? Select all ...Question: Which of the following correctly describes a compound? a. The atoms are bonded together, and the compound has different physical and chemical properties than the individual...Question: Question 26 Choose the correct answer: Which of the following best describes how compound interest works? [1 Mark] (a) Interest is calculated only on previously earned interest (b) The compound interest rate increases as the term progresses (c) Interest is calculated only at the end of the term (d) The compound interest rate increases as the …This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. Question: The figure shows the structures of glucose and fructose. Which of the following describes a difference between the two molecules? но H H-C-OH H-C-OH CO HOẠCH HOC-H H-C-OH H-COH H-C-OH H-C-OH H-C-OH H ...Which of the following best describes how compound interest works? a. The compound interest rate increases as the term progresses. b. Interest is calculated only at the end of the term. c. Interest is calculated only on previously earned interest. d. Interest is calculated and added to the previous balance to become the new balance. The compound would be expected to have a relatively low melting point. The compound is molecular. The compound is ionic. 3 Which of the following describes the compound Fe 2 (SO 4) 3? Choose all answers that apply. If the compound dissolved in water it would be a non-electrolyte. If the compound dissolved in water it would be a strong electrolyte.Study with Quizlet and memorize flashcards containing terms like NaCl and KBr are ionic compounds. H2O and C6H12O6 are covalent compounds. How does Vanessa describe the difference between the melting points and elemental compositions of ionic and covalent compounds?, Which of the following is the correct way to write the formula for the compound carbon tetrafluoride?, calcium and nitrogen and ...This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. See Answer. Question: uestion 16 Which of the following terms best describes ice floating in water? O A. compound OB. heterogeneous mixture O C. homogeneous mixture O D. substance E. none of the above.Chemistry. Chemistry questions and answers. The compound, CH3NH2, contains a C-N bond. Which of the following best describes the charge on the nitrogen atom in this compound? And why? a) -1 b) +1 c) Slightly Positive d) Slightly Negative e) Uncharged.E. The compound would be a good conductor of heat and electricity. Which of the following describes the compound PCl5? Choose all answers that apply. A. The compound is molecular. B. The compound would be expected to have a relatively low melting point. C.Study with Quizlet and memorize flashcards containing terms like What element propels music forward in time?, In a compound meter, the beat is divided into groups of, A common way composers create rhythmic interest is by shifting the accent to a _____ (also known as an _____) instead of emphasizing the _____ beat of the measure.Which of the following describes a heterogeneous mixture? carbon monoxide (CO) ... It may bond with sulfurto form the compound BeS. Beryllium is a(n) _____. element. Compounds beginning with the following nouns are usually printed solid. book mill snow eye play way horse school wood.Calcium fluoride, CaF2, is an example of _____. a metallic compound a polar covalent compound a covalent compound an ionic compound d Which of the following describes the reason for the following application of metals? long wires acting to carry power are strong but can be bent are shiny More than one of the answers are correct. Terms in this set (27) Which of the following is a chemical change? burning gasoline in your car. which of the following descriptions is used to describe the liquid state? matter in this state has a definite volume and the shape is determined by the container. which of the following is a chemical change? frying an egg.Study with Quizlet and memorize flashcards containing terms like Write the chemical formula of the ionic compound that is composed of Ti^4+ and O^-2 ions., To represent an ion, the charge of the ion is written as a right _______ next to the element symbol. If the charge is a number other than one, the number is usually written ________ the positive or negative sign., Which of the following ... ELEMENTS AND COMPOUNDS. Elements and Compounds. 1-1. Which of the following correctly describes one of the differences between compounds and mixtures? (a) compounds contain more than one element but mixtures do not (b) compounds have a constant composition but mixtures do notWhich of the following correctly describes chemical compounds? (Select all answers that apply.) A chemical compound can be represented by a chemical formula using elemental symbols and subscripts indicating the number of atoms of each element. A chemical compound is a physical combination of two or more elements.Define compound adjective: the definition of compound adjective is a phrase or set of words taken as a unit to modify a noun. In summary, a compound adjective is, an adjective that modifies a noun. made up of more than one word. usually hyphenated.Only 1. Match the molecular geometry and the number of lone pairs of electrons on the central atom: Bent geometry. - 0. - Only 1. - 1 or 2. 1 or 2. Match the atom with the number of lone pairs of electrons it will commonly possess in a Lewis structure: Carbon. - 0.What describes a compound? 1) In chemistry, a compound is a substance that results from a combination of two or more different chemical element s, in such a way that the atom s of the different elements are held together by chemical bonds that are difficult to break. The smallest unbreakable unit of a compound is called a molecule .A) Relatively few people on this planet are lactose intolerant. B) The ability to hydrolyze lactose would be equally beneficial to all human populations. C) Lactose tolerance has evolved independently in multiple different human populations. D) Lactose intolerance refers to a person's inability to produce the sugar lactose.C. The tert-butyl group is equatorial. D. The tert-butyl group is axial and the methyl group is equatorial. E. none of the above. C. Which of the following has two equatorial alkyl substituents in its most stable conformation? A. 1,1-dimethylcyclohexane. B. cis-1,2-dimethylcyclohexane C. cis-1,3-diethylcyclohexane.Which of the following describes a compound? (Hint: Carbon and Oxygen both appear on the periodic table.) A. a piece of pure carbon, containing only carbon atoms. B. oxygen gas surrounding a solid piece of carbon. C. a substance made of two oxygen atoms for each carbon atom. D. Carbon and Oxygen atoms mixed without …The next statement that best describes a compound or inorganic substance is the option that indicates that it is a compound without molecules containing carbon.. In the attached image some examples of inorganic compounds are named.. Inorganic chemical compound. Inorganic chemical compound is called all those that are formed …Solubility. 4.5: Solubility of Ionic Compounds is shared under a not declared license and was authored, remixed, and/or curated by LibreTexts. Solubility is the maximum amount of solute that can dissolve in specific amount of solvent. Not all ionic compounds are able soluble in water. We use the solubility rules to predict whether an ionic ….Study with Quizlet and memorize flashcards containing terms like Water is a polar molecule because it contains ____ covalent bonds and adopts a(n) ____ shape., Which of the following options describe the correct format used to represent a chemical compound?, In a(n) ____ bond electrons are not shared equally, but are closer to the more electronegative atom and more.Classification of Matter. 3.2K plays. 8th - 10th. 20 Qs. Classifying Matter. 8.3K plays. 9th - 10th. Compounds and Mixtures quiz for 5th grade students. Find other quizzes for Chemistry and more on Quizizz for free! Study with Quizlet and memorize flashcards containing terms like Which of the following best describes a compound?, When chemical bonds form, the valence electrons in an atom can undergo all of the following in relation to other atoms EXCEPT _____., The ratio of elements in the molecular compound ethyl alcohol is: carbon, 2; hydrogen, 6; oxygen, 1. Which is the formula for this compound? and more.This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. Question: Which of the following correctly describe the molecular mass of a compound? Click the answer you think is right. The sum of the atomic masses of all the elements of a compound The sum of the atomic numbers of a ...Terms in this set (27) Which of the following is a chemical change? burning gasoline in your car. which of the following descriptions is used to describe the liquid state? matter in this state has a definite volume and the shape is determined by the container. which of the following is a chemical change? frying an egg.Answer 4 people found it helpful PrincessTeja report flag outlined Answer: A compound is defined as a chemical substance in which two or more different elements …Chemical compound, any substance composed of identical molecules consisting of atoms of two or more chemical elements. All the matter in the universe is ...Calcium fluoride, CaF2, is an example of _____. a metallic compound a polar covalent compound a covalent compound an ionic compound d Which of the following describes the reason for the following application of metals? long wires acting to carry power are strong but can be bent are shiny More than one of the answers are correct.Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe how to name a binary molecular compound? Select all that apply., Greek numerical prefixes are used to indicate the number of atoms of a particular element present in a molecular compound. Four atoms of the same element will be named with the prefix ____, while the prefix ... Study with Quizlet and memorize flashcards containing terms like Which of the following statements correctly describe the structural features and reactivity of compounds containing a C-Z σ bond, where Z is a heteroatom such as oxygen? (Select all that apply., Which of the following are common structural features of organic compounds? (Select all that …A compound is a substance formed when two or more different elements bond together chemically. In the options provided, 'a substance made of two oxygen atoms for each carbon atom' describes a compound, specifically carbon dioxide (CO2). Explanation: In chemistry, a compound is a substance formed when two or more …Which of the following best describes a possible carbon compound? a) One carbon atom forms a quadruple bond with another carbon atom. b) One carbon atom forms a double bond with an oxygen atom and two single bonds with two hydrogen atoms. c) One carbon atom forms five single bonds with five hydrogen atoms. Study with Quizlet and memorize flashcards containing terms like Which of the following statements best describes the relationship between autotrophs and heterotrophs? A) Autotrophs produce their organic molecules from CO2 and other inorganic molecules, whereas heterotrophs obtain their organic molecules from compounds produced by …Which of the following are pure substances? Explain.(a) Calcium chloride, used to melt ice on roads, consists of twoelements, calcium and chlorine, in a fixed mass ratio.(b) Sulfur consists of sulfur atoms combined into octatomicmolecules.(c) Baking powder, a leavening agent, contains 26% to 30%sodium hydrogen carbonate and 30% to 35% calcium …Choose all answers that apply. The compound is ionic. The compound would be expected to be a solid at room temperature and pressure. If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. | If the compound dissolved in water it would be a non-electrolyte. Show transcribed image text. The next statement that best describes a compound or inorganic substance is the option that indicates that it is a compound without molecules containing carbon.. In the attached image some examples of inorganic compounds are named.. Inorganic chemical compound. Inorganic chemical compound is called all those that are formed …Study with Quizlet and memorize flashcards containing terms like Which statement best describes why water is an effective solvent? A. Water's relatively small size allows it to fit between individual atoms, driving them apart. B. Water is an ionic compound that attracts other like molecules. C. Water's hydrophobic nature separates polar and non …Study with Quizlet and memorize flashcards containing terms like which of the following quantities are equivalent to 1 mL? a.) 1x10^(-3)L b.) 1 cm^3 c.)0.001L d.)1000L, an experiment requires 42.5 g of sulfuric acid, which is easier to measure by volume than by mass. what volume in mL should be measures out, if the density of the sulfuric acid is 1.84 g/cm^3 a.)0.043 mL b.)23.1 mL c.) 78.2 mL ... Question: Question 26 Choose the correct answer: Which of the following best describes how compound interest works? [1 Mark] (a) Interest is calculated only on previously earned interest (b) The compound interest rate increases as the term progresses (c) Interest is calculated only at the end of the term (d) The compound interest rate increases as the …SmartBook 1. Which of the following statements correctly describe covalent compounds? Select all that apply. Click the card to flip 👆. Most of the compounds that we come in contact with are covalent compounds. Covalent compounds are formed by sharing electrons between atoms. Covalent compounds contain covalent bonds. B) A compound is exemplified by sodium. C) A compound contains two or more different elements in a fixed ratio. D) A compound is a pure element. Which of the following statements regarding matter is false? A) All life is composed of matter. B) All matter exists in the form of compounds. C) All matter has mass.Study with Quizlet and memorize flashcards containing terms like Which statement best describes why water is an effective solvent? A. Water's relatively small size allows it to fit between individual atoms, driving them apart. B. Water is an ionic compound that attracts other like molecules. C. Water's hydrophobic nature separates polar and non …Browse over 1 million classes created by top students, professors, publishers, and experts. Medical & Nursing. Humanities & Social Studies. Food & Beverage. Module 02: Atoms And Elements. Module 03: Molecules And Compounds. Module 04 : Reactions.The simplest Organic compounds are made up of only Carbon and Hydrogen atoms only. Compounds of Carbon and Hydrogen only are called Hydrocarbons. Alkanes. The ...Question: Spermine (structure shown) is a compound isolated from sperm. Which of the following statements correctly describes an aqueous solution of spermine? NH2(CH2)3NH(CH2)4NH(CH2)3NH2 Question 2 options: A) The hydroxide ion concentration in the solution would be greater than that in pure water.Study with Quizlet and memorize flashcards containing terms like What element propels music forward in time?, In a compound meter, the beat is divided into groups of, A common way composers create rhythmic interest is by shifting the accent to a _____ (also known as an _____) instead of emphasizing the _____ beat of the measure.Science. Chemistry. Chemistry questions and answers. .Which of the following describes an ionic compound dissolved in water? the partial negative ends of water molecules surround the anions & the partial positive ends of water molecules surround the cations. the partial negative ends of water molecules surround the negative ions & the partial ...Classify each of the following substances as an element, a compound, a homogeneous mixture, or a heterogeneous mixture. Sucrose, which is commonly-known as "table sugar" (C 12 H 22 O 11) 2.1: Classifications of Matter is shared under a not declared license and was authored, remixed, and/or curated by LibreTexts.Figure 3.1.3 3.1. 3: The Three-Dimensional Structures of Water, Ammonia, and Methane. (a) Water is a V-shaped molecule, in which all three atoms lie in a plane. (b) In contrast, ammonia has a pyramidal structure, in which the three hydrogen atoms form the base of the pyramid and the nitrogen atom is at the vertex.Ions are formed when atoms lose or gain electrons. F- is an example of an anion. In the compound MgO, the Mg ion has a charge of _____, while the O ion has a charge of _____. +2; -2. Match each type of bond to the correct description given. covalent bond ----> attraction between two nuclei and a shared pair of electrons.Chemical compound - Binary, Covalent, Molecules: Binary molecular (covalent) compounds are formed as the result of a reaction between two nonmetals. Although there are no ions in these compounds, they are named in a similar manner to binary ionic compounds. The nomenclature of binary covalent compounds follows these rules: …Study with Quizlet and memorize flashcards containing terms like Most organic compounds contain carbon and _____., The complexity and variety of organic molecules is due to, Compounds composed of only carbon atoms and hydrogen atoms are called _____. and more. ... Which of the following best describes cis-trans isomers? a. They have …Study with Quizlet and memorize flashcards containing terms like The term _____ is used to describe how well the electron cloud around an atom responds to changes in its electronic environment. A larger atom will hold its valence electrons _____ tightly than a smaller atom and will therefore have a greater response to the presence of a charged or polar particle nearby., Which of the following ...Final answer. Which of the following describes an ionic bond? A) found in most compounds in organisms B) involves sharing of electrons C) involves gaining or losing neutrons D) involves gaining or losing electrons A saturated lipid contains a A) more oxygen atoms than hydrogen atoms B) no double or triple bonds in the fatty acids chains C ...Which of the following describes a compound? (Hint: Carbon and Oxygen both appear on the periodic table.) A. a piece of pure carbon, containing only carbon atoms. B. oxygen gas surrounding a solid piece of carbon. C. a substance made of two oxygen atoms for each carbon atom. D. Carbon and Oxygen atoms mixed without …viscosity. A lobster grows a new claw...? regeneration. What is a body of mass around a mass? Satilite. Study with Quizlet and memorize flashcards containing terms like In chemistry, to be classified as an organic substance, a substance must contain...?, Which element does not contain any neutrons?, The chemical formula of a compound …1 millimeter = __________ meter. 0.001. Perform the following calculation and give the answer with the correct number of significant figures. 35,920 ÷ 172. 209. Gasoline has a density of 0.740 g/mL. If you have 328 grams of gasoline, what is the volume in milliliters?See Answer. Question: Which of the following describes the technique for recrystallizing a compound? O Dissolve the sample in the minimum amount of cold solvent and then heat it to boiling point. Dissolve the sample in a large volume of solvent and then evaporate the solvent using a rotary evaporator. O Dissolve the sample in the minimum amount ...Oc if the lon-dipole forces between the ions in the lonic compound and the dipole of the water molecules are stronger than the lon- ion forces holding the lonic compound in the solid state, the compound will dissolve in water. O d. Both a & b are correct. e Both a & care correct. Of. Both b&c are correct. O & None of the above statements are ...Final answer. Which of the following describes a neutralization reaction? a reaction in which multiple compounds or elements combine to form a single compound a reaction between chemically equivalent amounts of salt and water to form an acid and a base a reaction in which a single compound breaks down into multiple compounds or …User: Which of the following describes the formation of a compound sentence? Weegy: A compound sentence is formed by joining two simple sentences with a comma and a coordinating conjunction. Score 1 User: Whats a claim? Weegy: A claim is: a statement essentially arguable, but used as a primary point to support or prove an …The correct statements that apply to the compound are;. they show the elements that make up a compound; they show the types of atoms that make up a molecule; they show the number of each type of atom in a molecule; The chemical formula of water is written as;. The conclusions that can be drawn in the compound formed in …Which of the following describes a compound, us bank atm near me open now, walmart black out curtains
For example, NaCl, , etc are all compounds. Atoms of a compound can be separated by chemical means. Hence, we an conclude that the atoms can only combine in fixed ratios, and they can only be separated by a chemical change, correctly describes a compound.viscosity. A lobster grows a new claw...? regeneration. What is a body of mass around a mass? Satilite. Study with Quizlet and memorize flashcards containing terms like In chemistry, to be classified as an organic substance, a substance must contain...?, Which element does not contain any neutrons?, The chemical formula of a compound …Which of the following observations demonstrates that a solid sample is a compound? It cannot be broken down into simpler substances by physical methods. Which of the …Which of the following statements correctly describe covalent compounds? Select all that apply. Most of the compounds that we come in contact with are covalent compounds. Covalent compounds are formed by sharing electrons between atoms. Nitrogen, N2, is a covalent compound. question 2 people found it helpful saimaparvezVT report flag outlined The statement describes a compound: "two or more types of atoms chemically bonded together". The correct answer would be an option (C). What is the compound? Compounds are pure molecules made up of two or more separate elements ' atoms.Math Algebra Which of the following best describes the differences between simple and compound interest? a. simple interest is easier to calculate than compound interest b. simple interest earns interest on the previous interest earned only c. compound interest earns interest on the principal plus any previous interest earned d. compound ...Water, which is a chemical compound of hydrogen and oxygen in the ratio two hydrogen atoms for every oxygen atom, contains H 2 O molecules. Sodium chloride is a chemical compound formed from sodium (Na) and chlorine (Cl) in a 1:1 ratio. Although the formula for sodium chloride is NaCl, the compound does not contain actual NaCl molecules. …Expert Answer. 100% (5 ratings) Transcribed image text: Which of the following options correctly describe covalent compounds? Select all that apply. Check all that apply. V Covalent compounds form when a metal bonds to ampnmetal A covalent compound is formed when electrons are shared The smallest unit of a covalent compound is called a molecule. Study with Quizlet and memorize flashcards containing terms like Which of the following options describe the correct format used when writing the chemical formula of a substance? Select all that apply., When naming a compound of two nonmetals, the number of ____ of each element is indicated by a Greek numerical prefix. The first element in the name is numbered only when more than ___ atom(s ... Question: Which of the following correctly describes a compound? a. The atoms are bonded together, and the compound has different physical and chemical properties than the individual...The formation of a compound sentence is described as two independent clauses joined by a comma and a conjunction. Therefore, option C is the correct answer.Option A is incorrect because a semicolon is used to join two independent clauses in a complex sentence.Option B is incorrect because a dependent clause cannot form a …See Answer. Question: Which of the following describes the compound Mn (NO3)2? Choose all answers that apply. The compound is ionic. The compound is molecular. If the compound dissolved in water it would be a non-electrolyte. If the compound dissolved in water it would be a strong electrolyte. The compound would be expected to be a solid at ...This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. Question: Which of the following correctly describe the molecular mass of a compound? Click the answer you think is right. The sum of the atomic masses of all the elements of a compound The sum of the atomic numbers of a ...Which of the following best describes how compound interest works? a. The compound interest rate increases as the term progresses. b. Interest is calculated only at the end of the term. c. Interest is calculated only on previously earned interest. d. Interest is calculated and added to the previous balance to become the new balance.Which of the following best describes how compound interest works? a. The compound interest rate increases as the term progresses. b. Interest is calculated only at the end of the term. c. Interest is calculated only on previously earned interest. d. Interest is calculated and added to the previous balance to become the new balance.1. All organic compounds contain carbon atoms. 2. organic compounds may contain nitrogen or oxygen atoms. The central carbon atom in the structure shown is bonded to four different groups. This molecule is ___ and is ___ on its mirror image. The central carbon atom is therefore chiral.Chemistry. Chemistry questions and answers. The compound, CH3NH2, contains a C-N bond. Which of the following best describes the charge on the nitrogen atom in this compound? And why? a) -1 b) +1 c) Slightly Positive d) Slightly Negative e) Uncharged.Question: Which of the following describes what happens to the solubility of a slightly soluble ionic compound when common ion is added to the solution? The solubility of the ionic compound is increased The ionic compound diesolves more rapidly. More of the lonic compound dissolves. There is no effect on the solubility of the ionic compound.This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. Question: Which of the following describes an organic compound? A compound that contains the element carbon A compound that cannot be broken down by the cell A compound made up of carbohydrates A compound found only in ...In science, the term “insoluble” is used to describe substances with a low solubility. Solubility is the ability for a substance to dissolve when mixed with another substance to form a new compound.Ionic Compound Structure. The structure of an ionic compound depends on the relative sizes of the cations and anions. Ionic compounds include salts, oxides, hydroxides, sulphides, and the majority of inorganic compounds. Ionic solids are held together by the electrostatic attraction between the positive and negative ions.Question: Which of the following describes the compound NH4CH3COO? Choose all answers that apply. -The compound is ionic. -If the compound dissolved in water it would be a strong electrolyte. -The compound would be expected to be a solid at room temperature and pressure. -The compound is molecular. -If the compound dissolved in water it would ...Unit 3 Quiz. Which of the following terms describes a compound which increases or intensifies the activity of a receptor but is less effective than other active compounds? This compound can, therefore, decrease the effectiveness of more active compounds when in competition with them for the same receptor sites. a) antagonist.Classification of Matter. 3.2K plays. 8th - 10th. 20 Qs. Classifying Matter. 8.3K plays. 9th - 10th. Compounds and Mixtures quiz for 5th grade students. Find other quizzes for Chemistry and more on Quizizz for free! Classify each of the following substances as an element, a compound, a homogeneous mixture, or a heterogeneous mixture. Sucrose, which is commonly-known as "table sugar" (C 12 H 22 O 11) 2.1: Classifications of Matter is shared under a not declared license and was authored, remixed, and/or curated by LibreTexts.Q. Mixture have two or more substances chemically combined. 1) Some substances are made up of two or more elements combined together chemically. 2) Properties of these substances are different from their constituent elements. 3) These substances cannot be broken down by physical methods.Study with Quizlet and memorize flashcards containing terms like Which describes a series of chemical reactions that inactivate a drug by converting it to a water-soluble compound?, Which will cause drugs that are taken orally to be absorbed more quickly?, Which describe the effect of a drug that is mainly limited to the area where it is applied or enters the body? and more.A compound is a pure substance formed by the chemical combination of two or more different elements. A compound may be splitted into simpler substances by chemical reactions, and has different properties to those of the elements that form it. The composition of a compound is fixed: every piece of a compound has the same kind of …Question: Which of the following describes the compound Fe (CH3COO)3? Choose all answers that apply. If the compound dissolved in water it would be a non-electrolyte The compound is ionic. If the compound dissolved in water it would be a strong electrolyte. The compound would be expected to be a solid at room temperature and pressure. The ...Question: Which of the following describes the compound NH4CH3COO? Choose all answers that apply. -The compound is ionic. -If the compound dissolved in water it would be a strong electrolyte. -The compound would be expected to be a solid at room temperature and pressure. -The compound is molecular. -If the compound dissolved in …Study with Quizlet and memorize flashcards containing terms like Which one of the following compounds may be polymers? A.Carbohydrates C.Proteins B.Nucleic acids D.All of these, Carbon compounds that come from living organisms are called_____compounds., How many electrons can a carbon atom share? and more.Study with Quizlet and memorize flashcards containing terms like How many covalent bonds are formed by a neutral atom for each of the following elements?, Match. Marked bond in the structure shown with the correct description, In what way does the structural formula of a compound differ from its molecular formula? and more.Study with Quizlet and memorize flashcards containing terms like 5-3, Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound?, Which of the following structures are identical to the structure in the box? and more. Calcium fluoride, CaF2, is an example of _____. a metallic compound a polar covalent compound a covalent compound an ionic compound d Which of the following describes the reason for the following application of metals? long wires acting to carry power are strong but can be bent are shiny More than one of the answers are correct. Study with Quizlet and memorize flashcards containing terms like Which statement best describes why water is an effective solvent? A. Water's relatively small size allows it to fit between individual atoms, driving them apart. B. Water is an ionic compound that attracts other like molecules. C. Water's hydrophobic nature separates polar and non …This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. See Answer. Question: uestion 16 Which of the following terms best describes ice floating in water? O A. compound OB. heterogeneous mixture O C. homogeneous mixture O D. substance E. none of the above.Identify identical compounds. A and C. What is the relative priority of the CH3 group in the following compound? 3. E configuration. the highest priority groups are on the opposite side of the double bond. trans configuration. the H atoms are bonded on the opposite side of the C=C. Stereoisomers.Terms in this set (73) Which of the following species are the two products of respiration? Water. Carbon dioxide. mixture. Physical combination of two or more species. pure substance. Form of matter with a definite composition. Place the layers of Earth's atmosphere in the correct order, starting with the layer that is closest to Earth at the ...d.spiro bicyclic. 2.Which of the following describes the compound below? A. bridged bicyclic. B. spiro bicyclic. C. fused bicyclic. D. bridged tricyclic. 3.Choose the IUPAC name that best describes the following molecule. a.spiro [5.2]octane. b.bicyclo [3.2.1]octane.18.12. Which of the following best describes a result of the polar nature of water molecules? *A. Ionic compounds dissolve easily in water. B. The volume of ...Which of the following statements best describes a compound? a. A compound is a pure element. b. A compound contains two or more different elements in a fixed ratio. c. A compound is exemplified by sodium. d. A compound is a solution Daily interest compounding means there will be a difference between the annual percentage rate and the annual percentage yield. Knowing how to calculate the APY helps ensure you’re getting the best deal with your banking. When you take out ...Which of the following best describes a possible carbon compound? A. One carbon atom forms a quadruple bond with another carbon atom. B. One carbon atom forms a double bond with an oxygen atom and two single bonds with two hydrogen atoms. C. One carbon atom forms five single bonds with five hydrogen atoms. D.Which of the following correctly describes chemical compounds? (Select all answers that apply.) A chemical compound can be represented by a chemical formula using elemental symbols and subscripts indicating the number of atoms of each element. A chemical compound is a physical combination of two or more elements.Question 26. Choose the correct answer: Which of the following best describes how compound interest works? [1 Mark] (a) Interest is calculated only on previously earned interest (b) The compound interest rate increases as the term progresses (c) Interest is calculated only at the end of the term (d) The compound interest rate increases as the term progressesWhich of the following best describes a possible carbon compound? a) One carbon atom forms a quadruple bond with another carbon atom. b) One carbon atom forms a double bond with an oxygen atom and two single bonds with two hydrogen atoms. c) One carbon atom forms five single bonds with five hydrogen atoms. Organic chemistry is the study of. Compounds containing carbon and hydrogen. A structural or condensed structural formula will give more information about blank in the molecule then the simple molecular formula. The order in which Adams are bonded. Which of the following statements correctly describes Easters. Study with Quizlet and memorize flashcards containing terms like Which of the following statements describe a compound? a. a compound is a pure substance b. a compound …Final answer. Which of the following best describes an annuity? Deposits are made at random (whenever you have extra money) into an account earning interest. A lump sum is deposited into an account earning compound interest. Equal, regular deposits are made into an account earning interest. A lump sum is deposited into an account earning simple ...Terms in this set (27) Which of the following is a chemical change? burning gasoline in your car. which of the following descriptions is used to describe the liquid state? matter in this state has a definite volume and the shape is determined by the container. which of the following is a chemical change? frying an egg.Study with Quizlet and memorize flashcards containing terms like Which of the following best describes a compound?, When chemical bonds form, the valence electrons in an atom can undergo all of the following in relation to other atoms EXCEPT _____., The ratio of elements in the molecular compound ethyl alcohol is: carbon, 2; hydrogen, 6; oxygen, 1. Which is the formula for this compound? and more.Study with Quizlet and memorize flashcards containing terms like Rank the states of matter based on increasing strength of intermolecular forces, placing the state whose intermolecular forces are weakest at the top., Which of the following properties of liquids are influenced by intermolecular forces? Select all that apply., Which of the following statements correctly describe the surface ...The molecule possesses enantiotopic hydrogens. Which of the following statements describes the compound shown below? Y O The mirror image of this molecule is its enantiomer. O It is meso. O Its asymmetric center possesses the R configuration. O It is achiral. The molecule possesses enantiotopic hydrogens. BUY.Study with Quizlet and memorize flashcards containing terms like A substance that releases ions in solution when dissolved in water is called a(n)_____. This solution _____conduct electricity., Which of the following represent correctly written formula units?, Arrange the statements from top to bottom to describe general process for naming binary molecular …. Which of the following statements is true about taxes everfi, febo flame electric fireplace troubleshooting